C17H24INO4S — CID 102413540
N-[2-(cyclohexen-1-yl)ethyl]-2-iodo-4,5-dimethoxy-N-methylbenzenesulfonamide (PubChem CID 102413540) has the molecular formula C17H24INO4S and a molecular weight of 465.35 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-iodo-4,5-dimethoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-iodo-4,5-dimethoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102413540 |
| Molecular Formula | C17H24INO4S |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-iodo-4,5-dimethoxy-N-methylbenzenesulfonamide |
| SMILES | COc1cc(I)c(S(=O)(=O)N(C)CCC2=CCCCC2)cc1OC |
| InChI | InChI=1S/C17H24INO4S/c1-19(10-9-13-7-5-4-6-8-13)24(20,21)17-12-16(23-3)15(22-2)11-14(17)18/h7,11-12H,4-6,8-10H2,1-3H3 |
| InChIKey | NQLNDSPJZMHHJG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|