C15H20ClNO4S — CID 25248835
4-chloro-N-(cyclohexen-1-ylmethyl)-2,5-dimethoxybenzenesulfonamide (PubChem CID 25248835) has the molecular formula C15H20ClNO4S and a molecular weight of 345.85 g/mol. Its IUPAC name is 4-chloro-N-(cyclohexen-1-ylmethyl)-2,5-dimethoxybenzenesulfonamide.
| Compound Name | 4-chloro-N-(cyclohexen-1-ylmethyl)-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 25248835 |
| Molecular Formula | C15H20ClNO4S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-chloro-N-(cyclohexen-1-ylmethyl)-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NCC2=CCCCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C15H20ClNO4S/c1-20-13-9-15(14(21-2)8-12(13)16)22(18,19)17-10-11-6-4-3-5-7-11/h6,8-9,17H,3-5,7,10H2,1-2H3 |
| InChIKey | JKDAGJOIOLSWSW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|