C19H24BrNO4 — CID 7568813
(2R)-2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 7568813) has the molecular formula C19H24BrNO4 and a molecular weight of 410.31 g/mol. Its IUPAC name is (2R)-2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | (2R)-2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 7568813 |
| Molecular Formula | C19H24BrNO4 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (2R)-2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | COc1cc(Br)c(C=O)cc1O[C@H](C)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H24BrNO4/c1-13(19(23)21-9-8-14-6-4-3-5-7-14)25-18-10-15(12-22)16(20)11-17(18)24-2/h6,10-13H,3-5,7-9H2,1-2H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | KJMKJSAXABWKMO-CYBMUJFWSA-N |
| XLogP | 4.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|