C11H14BrNO4S — CID 60664998
2-bromo-4,5-dimethoxy-N-prop-2-enylbenzenesulfonamide (PubChem CID 60664998) has the molecular formula C11H14BrNO4S and a molecular weight of 336.21 g/mol. Its IUPAC name is 2-bromo-4,5-dimethoxy-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 2-bromo-4,5-dimethoxy-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 60664998 |
| Molecular Formula | C11H14BrNO4S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 2-bromo-4,5-dimethoxy-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C11H14BrNO4S/c1-4-5-13-18(14,15)11-7-10(17-3)9(16-2)6-8(11)12/h4,6-7,13H,1,5H2,2-3H3 |
| InChIKey | XVAAWDGBAAFXDG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|