C18H18F2N2O4S — CID 120764903
methyl 2-fluoro-6-[2-(3-fluorophenyl)piperazin-1-yl]sulfonylbenzoate (PubChem CID 120764903) has the molecular formula C18H18F2N2O4S and a molecular weight of 396.42 g/mol. Its IUPAC name is methyl 2-fluoro-6-[2-(3-fluorophenyl)piperazin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 2-fluoro-6-[2-(3-fluorophenyl)piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 120764903 |
| Molecular Formula | C18H18F2N2O4S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | methyl 2-fluoro-6-[2-(3-fluorophenyl)piperazin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1c(F)cccc1S(=O)(=O)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C18H18F2N2O4S/c1-26-18(23)17-14(20)6-3-7-16(17)27(24,25)22-9-8-21-11-15(22)12-4-2-5-13(19)10-12/h2-7,10,15,21H,8-9,11H2,1H3 |
| InChIKey | CKJKIRDYMXSHDU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |