C16H15FN4O3S — CID 120764643
4-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole (PubChem CID 120764643) has the molecular formula C16H15FN4O3S and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole.
| Compound Name | 4-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 120764643 |
| Molecular Formula | C16H15FN4O3S |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole |
| SMILES | O=S(=O)(c1cccc2nonc12)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C16H15FN4O3S/c17-12-4-1-3-11(9-12)14-10-18-7-8-21(14)25(22,23)15-6-2-5-13-16(15)20-24-19-13/h1-6,9,14,18H,7-8,10H2 |
| InChIKey | BZKOOSBBSHLDDH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |