C16H25ClN2O2S — CID 120765493
1-but-3-enylsulfonyl-2-(4-ethylphenyl)piperazine;hydrochloride (PubChem CID 120765493) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is 1-but-3-enylsulfonyl-2-(4-ethylphenyl)piperazine;hydrochloride.
| Compound Name | 1-but-3-enylsulfonyl-2-(4-ethylphenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120765493 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-but-3-enylsulfonyl-2-(4-ethylphenyl)piperazine;hydrochloride |
| SMILES | C=CCCS(=O)(=O)N1CCNCC1c1ccc(CC)cc1.Cl |
| InChI | InChI=1S/C16H24N2O2S.ClH/c1-3-5-12-21(19,20)18-11-10-17-13-16(18)15-8-6-14(4-2)7-9-15;/h3,6-9,16-17H,1,4-5,10-13H2,2H3;1H |
| InChIKey | SRNQSYYSMABZKB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|