C19H24N2O5S — CID 120765458
ethyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 120765458) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is ethyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 120765458 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | ethyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCNCC2c2ccc(CC)cc2)o1 |
| InChI | InChI=1S/C19H24N2O5S/c1-3-14-5-7-15(8-6-14)16-13-20-11-12-21(16)27(23,24)18-10-9-17(26-18)19(22)25-4-2/h5-10,16,20H,3-4,11-13H2,1-2H3 |
| InChIKey | OKZLGVIPTMPGHL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |