C19H19F2N3O2S — CID 120765606
4-[2-(4-ethylphenyl)piperazin-1-yl]sulfonyl-3,5-difluorobenzonitrile (PubChem CID 120765606) has the molecular formula C19H19F2N3O2S and a molecular weight of 391.44 g/mol. Its IUPAC name is 4-[2-(4-ethylphenyl)piperazin-1-yl]sulfonyl-3,5-difluorobenzonitrile.
| Compound Name | 4-[2-(4-ethylphenyl)piperazin-1-yl]sulfonyl-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 120765606 |
| Molecular Formula | C19H19F2N3O2S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-[2-(4-ethylphenyl)piperazin-1-yl]sulfonyl-3,5-difluorobenzonitrile |
| SMILES | CCc1ccc(C2CNCCN2S(=O)(=O)c2c(F)cc(C#N)cc2F)cc1 |
| InChI | InChI=1S/C19H19F2N3O2S/c1-2-13-3-5-15(6-4-13)18-12-23-7-8-24(18)27(25,26)19-16(20)9-14(11-22)10-17(19)21/h3-6,9-10,18,23H,2,7-8,12H2,1H3 |
| InChIKey | SIWLCTRYBBNHEQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |