C12H16N6O2S — CID 120876698
1-(3-methyltriazol-4-yl)sulfonyl-2-pyridin-3-ylpiperazine (PubChem CID 120876698) has the molecular formula C12H16N6O2S and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-(3-methyltriazol-4-yl)sulfonyl-2-pyridin-3-ylpiperazine.
| Compound Name | 1-(3-methyltriazol-4-yl)sulfonyl-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120876698 |
| Molecular Formula | C12H16N6O2S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-(3-methyltriazol-4-yl)sulfonyl-2-pyridin-3-ylpiperazine |
| SMILES | Cn1nncc1S(=O)(=O)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C12H16N6O2S/c1-17-12(9-15-16-17)21(19,20)18-6-5-14-8-11(18)10-3-2-4-13-7-10/h2-4,7,9,11,14H,5-6,8H2,1H3 |
| InChIKey | CPLJASZIVQJXFP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |