C15H19ClN8O2S — CID 120895051
2-(1-methylimidazol-2-yl)-1-[3-(tetrazol-1-yl)phenyl]sulfonylpiperazine;hydrochloride (PubChem CID 120895051) has the molecular formula C15H19ClN8O2S and a molecular weight of 410.89 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-1-[3-(tetrazol-1-yl)phenyl]sulfonylpiperazine;hydrochloride.
| Compound Name | 2-(1-methylimidazol-2-yl)-1-[3-(tetrazol-1-yl)phenyl]sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120895051 |
| Molecular Formula | C15H19ClN8O2S |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-1-[3-(tetrazol-1-yl)phenyl]sulfonylpiperazine;hydrochloride |
| SMILES | Cl.Cn1ccnc1C1CNCCN1S(=O)(=O)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C15H18N8O2S.ClH/c1-21-7-6-17-15(21)14-10-16-5-8-23(14)26(24,25)13-4-2-3-12(9-13)22-11-18-19-20-22;/h2-4,6-7,9,11,14,16H,5,8,10H2,1H3;1H |
| InChIKey | IZOCDXYMPCHRQM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |