C14H18ClN3O4S — CID 119970068
2-methyl-5-(2-methylpiperazin-1-yl)sulfonylisoindole-1,3-dione;hydrochloride (PubChem CID 119970068) has the molecular formula C14H18ClN3O4S and a molecular weight of 359.84 g/mol. Its IUPAC name is 2-methyl-5-(2-methylpiperazin-1-yl)sulfonylisoindole-1,3-dione;hydrochloride.
| Compound Name | 2-methyl-5-(2-methylpiperazin-1-yl)sulfonylisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119970068 |
| Molecular Formula | C14H18ClN3O4S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-methyl-5-(2-methylpiperazin-1-yl)sulfonylisoindole-1,3-dione;hydrochloride |
| SMILES | CC1CNCCN1S(=O)(=O)c1ccc2c(c1)C(=O)N(C)C2=O.Cl |
| InChI | InChI=1S/C14H17N3O4S.ClH/c1-9-8-15-5-6-17(9)22(20,21)10-3-4-11-12(7-10)14(19)16(2)13(11)18;/h3-4,7,9,15H,5-6,8H2,1-2H3;1H |
| InChIKey | CILDHUODDOFSKH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|