C16H21FN4O2S — CID 120715285
1-[3-fluoro-4-(4-methylpyrazol-1-yl)phenyl]sulfonyl-N-methylpiperidin-3-amine (PubChem CID 120715285) has the molecular formula C16H21FN4O2S and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4-methylpyrazol-1-yl)phenyl]sulfonyl-N-methylpiperidin-3-amine.
| Compound Name | 1-[3-fluoro-4-(4-methylpyrazol-1-yl)phenyl]sulfonyl-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 120715285 |
| Molecular Formula | C16H21FN4O2S |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-[3-fluoro-4-(4-methylpyrazol-1-yl)phenyl]sulfonyl-N-methylpiperidin-3-amine |
| SMILES | CNC1CCCN(S(=O)(=O)c2ccc(-n3cc(C)cn3)c(F)c2)C1 |
| InChI | InChI=1S/C16H21FN4O2S/c1-12-9-19-21(10-12)16-6-5-14(8-15(16)17)24(22,23)20-7-3-4-13(11-20)18-2/h5-6,8-10,13,18H,3-4,7,11H2,1-2H3 |
| InChIKey | KLCIZHBWGDQJKT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |