C12H19BrN2O2S2 — CID 55258588
N-[[1-(3-bromothiophen-2-yl)sulfonylpiperidin-3-yl]methyl]ethanamine (PubChem CID 55258588) has the molecular formula C12H19BrN2O2S2 and a molecular weight of 367.33 g/mol. Its IUPAC name is N-[[1-(3-bromothiophen-2-yl)sulfonylpiperidin-3-yl]methyl]ethanamine.
| Compound Name | N-[[1-(3-bromothiophen-2-yl)sulfonylpiperidin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 55258588 |
| Molecular Formula | C12H19BrN2O2S2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N-[[1-(3-bromothiophen-2-yl)sulfonylpiperidin-3-yl]methyl]ethanamine |
| SMILES | CCNCC1CCCN(S(=O)(=O)c2sccc2Br)C1 |
| InChI | InChI=1S/C12H19BrN2O2S2/c1-2-14-8-10-4-3-6-15(9-10)19(16,17)12-11(13)5-7-18-12/h5,7,10,14H,2-4,6,8-9H2,1H3 |
| InChIKey | UXLMLNOOCLJQGZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |