C12H15Br2N3O3S — CID 52865075
4-(2,5-dibromophenyl)sulfonyl-1,4-diazepane-1-carboxamide (PubChem CID 52865075) has the molecular formula C12H15Br2N3O3S and a molecular weight of 441.15 g/mol. Its IUPAC name is 4-(2,5-dibromophenyl)sulfonyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(2,5-dibromophenyl)sulfonyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 52865075 |
| Molecular Formula | C12H15Br2N3O3S |
| Molecular Weight | 441.15 g/mol |
| Exact Mass | 438.92 |
| IUPAC Name | 4-(2,5-dibromophenyl)sulfonyl-1,4-diazepane-1-carboxamide |
| SMILES | NC(=O)N1CCCN(S(=O)(=O)c2cc(Br)ccc2Br)CC1 |
| InChI | InChI=1S/C12H15Br2N3O3S/c13-9-2-3-10(14)11(8-9)21(19,20)17-5-1-4-16(6-7-17)12(15)18/h2-3,8H,1,4-7H2,(H2,15,18) |
| InChIKey | DDNPJMRLUMKGSW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |