C11H12Br2N2O3S — CID 64695379
4-(2,4-dibromophenyl)sulfonyl-1-methylpiperazin-2-one (PubChem CID 64695379) has the molecular formula C11H12Br2N2O3S and a molecular weight of 412.10 g/mol. Its IUPAC name is 4-(2,4-dibromophenyl)sulfonyl-1-methylpiperazin-2-one.
| Compound Name | 4-(2,4-dibromophenyl)sulfonyl-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 64695379 |
| Molecular Formula | C11H12Br2N2O3S |
| Molecular Weight | 412.10 g/mol |
| Exact Mass | 409.89 |
| IUPAC Name | 4-(2,4-dibromophenyl)sulfonyl-1-methylpiperazin-2-one |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(Br)cc2Br)CC1=O |
| InChI | InChI=1S/C11H12Br2N2O3S/c1-14-4-5-15(7-11(14)16)19(17,18)10-3-2-8(12)6-9(10)13/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | HIUQJTHFYXBXPY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.10 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |