C13H16Br2N2O2S — CID 61233880
8-(2,4-dibromophenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 61233880) has the molecular formula C13H16Br2N2O2S and a molecular weight of 424.16 g/mol. Its IUPAC name is 8-(2,4-dibromophenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | 8-(2,4-dibromophenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 61233880 |
| Molecular Formula | C13H16Br2N2O2S |
| Molecular Weight | 424.16 g/mol |
| Exact Mass | 421.93 |
| IUPAC Name | 8-(2,4-dibromophenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | NC1CC2CCC(C1)N2S(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H16Br2N2O2S/c14-8-1-4-13(12(15)5-8)20(18,19)17-10-2-3-11(17)7-9(16)6-10/h1,4-5,9-11H,2-3,6-7,16H2 |
| InChIKey | AWFXOYFDLIVYCX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |