C11H15BrN2O2S2 — CID 61234061
8-(5-bromothiophen-2-yl)sulfonyl-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 61234061) has the molecular formula C11H15BrN2O2S2 and a molecular weight of 351.29 g/mol. Its IUPAC name is 8-(5-bromothiophen-2-yl)sulfonyl-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | 8-(5-bromothiophen-2-yl)sulfonyl-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 61234061 |
| Molecular Formula | C11H15BrN2O2S2 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 8-(5-bromothiophen-2-yl)sulfonyl-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | NC1CC2CCC(C1)N2S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H15BrN2O2S2/c12-10-3-4-11(17-10)18(15,16)14-8-1-2-9(14)6-7(13)5-8/h3-4,7-9H,1-2,5-6,13H2 |
| InChIKey | HWIPGAAVPRULOA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |