C13H17BrN2O3S — CID 102847434
4-(2-bromo-4-methylphenyl)sulfonyl-1-methyl-1,4-diazepan-2-one (PubChem CID 102847434) has the molecular formula C13H17BrN2O3S and a molecular weight of 361.26 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenyl)sulfonyl-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(2-bromo-4-methylphenyl)sulfonyl-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102847434 |
| Molecular Formula | C13H17BrN2O3S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 4-(2-bromo-4-methylphenyl)sulfonyl-1-methyl-1,4-diazepan-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(C)C(=O)C2)c(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O3S/c1-10-4-5-12(11(14)8-10)20(18,19)16-7-3-6-15(2)13(17)9-16/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | XLDVOAVENQPVCB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |