C15H17BrN4O2S — CID 52567580
2-[4-(2-bromo-4-methylphenyl)sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 52567580) has the molecular formula C15H17BrN4O2S and a molecular weight of 397.30 g/mol. Its IUPAC name is 2-[4-(2-bromo-4-methylphenyl)sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-(2-bromo-4-methylphenyl)sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 52567580 |
| Molecular Formula | C15H17BrN4O2S |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 2-[4-(2-bromo-4-methylphenyl)sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3ncccn3)CC2)c(Br)c1 |
| InChI | InChI=1S/C15H17BrN4O2S/c1-12-3-4-14(13(16)11-12)23(21,22)20-9-7-19(8-10-20)15-17-5-2-6-18-15/h2-6,11H,7-10H2,1H3 |
| InChIKey | POLYNNJCWMVYBC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |