C18H19F3N2O3S2 — CID 38753324
(4-ethyl-5-methylthiophen-2-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 38753324) has the molecular formula C18H19F3N2O3S2 and a molecular weight of 432.49 g/mol. Its IUPAC name is (4-ethyl-5-methylthiophen-2-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (4-ethyl-5-methylthiophen-2-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 38753324 |
| Molecular Formula | C18H19F3N2O3S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | (4-ethyl-5-methylthiophen-2-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CCc1cc(C(=O)N2CCN(S(=O)(=O)c3ccc(F)c(F)c3F)CC2)sc1C |
| InChI | InChI=1S/C18H19F3N2O3S2/c1-3-12-10-14(27-11(12)2)18(24)22-6-8-23(9-7-22)28(25,26)15-5-4-13(19)16(20)17(15)21/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | WIXMQISKGSALIF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|