C15H22ClNO2S — CID 79184083
1-[5-(chloromethyl)-2,3-dimethylphenyl]sulfonyl-3,4-dimethylpyrrolidine (PubChem CID 79184083) has the molecular formula C15H22ClNO2S and a molecular weight of 315.87 g/mol. Its IUPAC name is 1-[5-(chloromethyl)-2,3-dimethylphenyl]sulfonyl-3,4-dimethylpyrrolidine.
| Compound Name | 1-[5-(chloromethyl)-2,3-dimethylphenyl]sulfonyl-3,4-dimethylpyrrolidine |
|---|---|
| PubChem CID | 79184083 |
| Molecular Formula | C15H22ClNO2S |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-[5-(chloromethyl)-2,3-dimethylphenyl]sulfonyl-3,4-dimethylpyrrolidine |
| SMILES | Cc1cc(CCl)cc(S(=O)(=O)N2CC(C)C(C)C2)c1C |
| InChI | InChI=1S/C15H22ClNO2S/c1-10-5-14(7-16)6-15(13(10)4)20(18,19)17-8-11(2)12(3)9-17/h5-6,11-12H,7-9H2,1-4H3 |
| InChIKey | XFCIDXPPNCNBLG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|