C14H20BrClN2O2S — CID 81480971
4-[3-bromo-5-(chloromethyl)-2-methylphenyl]sulfonyl-1,2-dimethylpiperazine (PubChem CID 81480971) has the molecular formula C14H20BrClN2O2S and a molecular weight of 395.75 g/mol. Its IUPAC name is 4-[3-bromo-5-(chloromethyl)-2-methylphenyl]sulfonyl-1,2-dimethylpiperazine.
| Compound Name | 4-[3-bromo-5-(chloromethyl)-2-methylphenyl]sulfonyl-1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 81480971 |
| Molecular Formula | C14H20BrClN2O2S |
| Molecular Weight | 395.75 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 4-[3-bromo-5-(chloromethyl)-2-methylphenyl]sulfonyl-1,2-dimethylpiperazine |
| SMILES | Cc1c(Br)cc(CCl)cc1S(=O)(=O)N1CCN(C)C(C)C1 |
| InChI | InChI=1S/C14H20BrClN2O2S/c1-10-9-18(5-4-17(10)3)21(19,20)14-7-12(8-16)6-13(15)11(14)2/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | UGWGFAQTIOHZHS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|