C12H17BrFN3O2S — CID 106491777
4-bromo-2-(3,4-dimethylpiperazin-1-yl)sulfonyl-5-fluoroaniline (PubChem CID 106491777) has the molecular formula C12H17BrFN3O2S and a molecular weight of 366.26 g/mol. Its IUPAC name is 4-bromo-2-(3,4-dimethylpiperazin-1-yl)sulfonyl-5-fluoroaniline.
| Compound Name | 4-bromo-2-(3,4-dimethylpiperazin-1-yl)sulfonyl-5-fluoroaniline |
|---|---|
| PubChem CID | 106491777 |
| Molecular Formula | C12H17BrFN3O2S |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 4-bromo-2-(3,4-dimethylpiperazin-1-yl)sulfonyl-5-fluoroaniline |
| SMILES | CC1CN(S(=O)(=O)c2cc(Br)c(F)cc2N)CCN1C |
| InChI | InChI=1S/C12H17BrFN3O2S/c1-8-7-17(4-3-16(8)2)20(18,19)12-5-9(13)10(14)6-11(12)15/h5-6,8H,3-4,7,15H2,1-2H3 |
| InChIKey | PSFRADZLBVRSEI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|