C13H18ClNO2S2 — CID 113336365
2-[5-(2-chloroethyl)thiophen-2-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 113336365) has the molecular formula C13H18ClNO2S2 and a molecular weight of 319.88 g/mol. Its IUPAC name is 2-[5-(2-chloroethyl)thiophen-2-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-[5-(2-chloroethyl)thiophen-2-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 113336365 |
| Molecular Formula | C13H18ClNO2S2 |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-[5-(2-chloroethyl)thiophen-2-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | O=S(=O)(c1ccc(CCCl)s1)N1CC2CCCC2C1 |
| InChI | InChI=1S/C13H18ClNO2S2/c14-7-6-12-4-5-13(18-12)19(16,17)15-8-10-2-1-3-11(10)9-15/h4-5,10-11H,1-3,6-9H2 |
| InChIKey | CUTNGVRBUCIVMS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|