C22H26BrNO5S — CID 4692166
2-(4-bromophenoxy)ethyl 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 4692166) has the molecular formula C22H26BrNO5S and a molecular weight of 496.42 g/mol. Its IUPAC name is 2-(4-bromophenoxy)ethyl 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | 2-(4-bromophenoxy)ethyl 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 4692166 |
| Molecular Formula | C22H26BrNO5S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 2-(4-bromophenoxy)ethyl 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(C(=O)OCCOc3ccc(Br)cc3)cc2)C1 |
| InChI | InChI=1S/C22H26BrNO5S/c1-16-13-17(2)15-24(14-16)30(26,27)21-9-3-18(4-10-21)22(25)29-12-11-28-20-7-5-19(23)6-8-20/h3-10,16-17H,11-15H2,1-2H3 |
| InChIKey | ZJGKLZPBNCUUEW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|