C10H15BrN2O2S2 — CID 103416177
5-(4-bromo-3-methylpiperidin-1-yl)sulfonyl-2-methyl-1,3-thiazole (PubChem CID 103416177) has the molecular formula C10H15BrN2O2S2 and a molecular weight of 339.28 g/mol. Its IUPAC name is 5-(4-bromo-3-methylpiperidin-1-yl)sulfonyl-2-methyl-1,3-thiazole.
| Compound Name | 5-(4-bromo-3-methylpiperidin-1-yl)sulfonyl-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 103416177 |
| Molecular Formula | C10H15BrN2O2S2 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 5-(4-bromo-3-methylpiperidin-1-yl)sulfonyl-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(S(=O)(=O)N2CCC(Br)C(C)C2)s1 |
| InChI | InChI=1S/C10H15BrN2O2S2/c1-7-6-13(4-3-9(7)11)17(14,15)10-5-12-8(2)16-10/h5,7,9H,3-4,6H2,1-2H3 |
| InChIKey | RUUNUPQBFDDTFN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|