C9H13ClN2O2S2 — CID 177318955
2-(1-methylpiperidin-3-yl)-1,3-thiazole-5-sulfonyl chloride (PubChem CID 177318955) has the molecular formula C9H13ClN2O2S2 and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-(1-methylpiperidin-3-yl)-1,3-thiazole-5-sulfonyl chloride.
| Compound Name | 2-(1-methylpiperidin-3-yl)-1,3-thiazole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 177318955 |
| Molecular Formula | C9H13ClN2O2S2 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 2-(1-methylpiperidin-3-yl)-1,3-thiazole-5-sulfonyl chloride |
| SMILES | CN1CCCC(c2ncc(S(=O)(=O)Cl)s2)C1 |
| InChI | InChI=1S/C9H13ClN2O2S2/c1-12-4-2-3-7(6-12)9-11-5-8(15-9)16(10,13)14/h5,7H,2-4,6H2,1H3 |
| InChIKey | VOQVAXBHWAMXEH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |