C11H18N4O3S3 — CID 103415739
N'-hydroxy-4-methylsulfanyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperidine-4-carboximidamide (PubChem CID 103415739) has the molecular formula C11H18N4O3S3 and a molecular weight of 350.49 g/mol. Its IUPAC name is N'-hydroxy-4-methylsulfanyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperidine-4-carboximidamide.
| Compound Name | N'-hydroxy-4-methylsulfanyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 103415739 |
| Molecular Formula | C11H18N4O3S3 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N'-hydroxy-4-methylsulfanyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperidine-4-carboximidamide |
| SMILES | CSC1(C(N)=NO)CCN(S(=O)(=O)c2cnc(C)s2)CC1 |
| InChI | InChI=1S/C11H18N4O3S3/c1-8-13-7-9(20-8)21(17,18)15-5-3-11(19-2,4-6-15)10(12)14-16/h7,16H,3-6H2,1-2H3,(H2,12,14) |
| InChIKey | HUQYNTVWCZSOAL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|