C23H24Cl2N2O6 — CID 108930362
[4-[[1-[2-(2,4-dichlorophenoxy)acetyl]piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108930362) has the molecular formula C23H24Cl2N2O6 and a molecular weight of 495.36 g/mol. Its IUPAC name is [4-[[1-[2-(2,4-dichlorophenoxy)acetyl]piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[1-[2-(2,4-dichlorophenoxy)acetyl]piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108930362 |
| Molecular Formula | C23H24Cl2N2O6 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | [4-[[1-[2-(2,4-dichlorophenoxy)acetyl]piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NC2CCN(C(=O)COc3ccc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C23H24Cl2N2O6/c1-2-31-23(30)33-18-6-3-15(4-7-18)22(29)26-17-9-11-27(12-10-17)21(28)14-32-20-8-5-16(24)13-19(20)25/h3-8,13,17H,2,9-12,14H2,1H3,(H,26,29) |
| InChIKey | AGZDFOZPHNWGHV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|