C23H25FN2O5 — CID 108929588
ethyl [4-[4-[3-(2-fluorophenyl)propanoyl]piperazine-1-carbonyl]phenyl] carbonate (PubChem CID 108929588) has the molecular formula C23H25FN2O5 and a molecular weight of 428.46 g/mol. Its IUPAC name is ethyl [4-[4-[3-(2-fluorophenyl)propanoyl]piperazine-1-carbonyl]phenyl] carbonate.
| Compound Name | ethyl [4-[4-[3-(2-fluorophenyl)propanoyl]piperazine-1-carbonyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108929588 |
| Molecular Formula | C23H25FN2O5 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | ethyl [4-[4-[3-(2-fluorophenyl)propanoyl]piperazine-1-carbonyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCN(C(=O)CCc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C23H25FN2O5/c1-2-30-23(29)31-19-10-7-18(8-11-19)22(28)26-15-13-25(14-16-26)21(27)12-9-17-5-3-4-6-20(17)24/h3-8,10-11H,2,9,12-16H2,1H3 |
| InChIKey | DQHGMMVFORDQKV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|