C19H33N3O5 — CID 108557732
N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]-2-(2-methoxyethoxy)acetamide (PubChem CID 108557732) has the molecular formula C19H33N3O5 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 108557732 |
| Molecular Formula | C19H33N3O5 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NC1CCN(C(=O)C2CC(=O)N(C(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C19H33N3O5/c1-19(2,3)22-12-14(11-17(22)24)18(25)21-7-5-15(6-8-21)20-16(23)13-27-10-9-26-4/h14-15H,5-13H2,1-4H3,(H,20,23) |
| InChIKey | UQAQBKWEWIAZRX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|