C23H30N2O4S — CID 60578028
N-[1-(3,4-dipropoxybenzoyl)piperidin-4-yl]thiophene-3-carboxamide (PubChem CID 60578028) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-[1-(3,4-dipropoxybenzoyl)piperidin-4-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-(3,4-dipropoxybenzoyl)piperidin-4-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 60578028 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[1-(3,4-dipropoxybenzoyl)piperidin-4-yl]thiophene-3-carboxamide |
| SMILES | CCCOc1ccc(C(=O)N2CCC(NC(=O)c3ccsc3)CC2)cc1OCCC |
| InChI | InChI=1S/C23H30N2O4S/c1-3-12-28-20-6-5-17(15-21(20)29-13-4-2)23(27)25-10-7-19(8-11-25)24-22(26)18-9-14-30-16-18/h5-6,9,14-16,19H,3-4,7-8,10-13H2,1-2H3,(H,24,26) |
| InChIKey | ANDRGZMISGICPU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |