C21H21Cl2N3O3 — CID 108553848
3-acetamido-N-[1-(2,5-dichlorobenzoyl)piperidin-4-yl]benzamide (PubChem CID 108553848) has the molecular formula C21H21Cl2N3O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is 3-acetamido-N-[1-(2,5-dichlorobenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 3-acetamido-N-[1-(2,5-dichlorobenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108553848 |
| Molecular Formula | C21H21Cl2N3O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 3-acetamido-N-[1-(2,5-dichlorobenzoyl)piperidin-4-yl]benzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)NC2CCN(C(=O)c3cc(Cl)ccc3Cl)CC2)c1 |
| InChI | InChI=1S/C21H21Cl2N3O3/c1-13(27)24-17-4-2-3-14(11-17)20(28)25-16-7-9-26(10-8-16)21(29)18-12-15(22)5-6-19(18)23/h2-6,11-12,16H,7-10H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | NEUNYXUHKYKZDG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |