C23H21F2N3O2 — CID 108561657
N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]-4-pyrrol-1-ylbenzamide (PubChem CID 108561657) has the molecular formula C23H21F2N3O2 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 108561657 |
| Molecular Formula | C23H21F2N3O2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccc(F)cc2F)CC1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C23H21F2N3O2/c24-17-5-8-20(21(25)15-17)23(30)28-13-9-18(10-14-28)26-22(29)16-3-6-19(7-4-16)27-11-1-2-12-27/h1-8,11-12,15,18H,9-10,13-14H2,(H,26,29) |
| InChIKey | FPVUMXYFMYBZQZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |