C20H21FN2O4 — CID 108558137
N-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-3,5-dihydroxybenzamide (PubChem CID 108558137) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is N-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-3,5-dihydroxybenzamide.
| Compound Name | N-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 108558137 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-3,5-dihydroxybenzamide |
| SMILES | O=C(NC1CCN(C(=O)Cc2ccc(F)cc2)CC1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C20H21FN2O4/c21-15-3-1-13(2-4-15)9-19(26)23-7-5-16(6-8-23)22-20(27)14-10-17(24)12-18(25)11-14/h1-4,10-12,16,24-25H,5-9H2,(H,22,27) |
| InChIKey | GLRORTUASYRZMZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |