C16H24N4O2 — CID 127165622
N-[1-(butylcarbamoyl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 127165622) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[1-(butylcarbamoyl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-(butylcarbamoyl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 127165622 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-[1-(butylcarbamoyl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | CCCCNC(=O)N1CCC(NC(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C16H24N4O2/c1-2-3-9-18-16(22)20-10-6-14(7-11-20)19-15(21)13-5-4-8-17-12-13/h4-5,8,12,14H,2-3,6-7,9-11H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | KMPDVPKQUWCKFQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|