C21H31N3O2 — CID 47076419
N-[1-(4-cyclohexylbutanoyl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 47076419) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[1-(4-cyclohexylbutanoyl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-(4-cyclohexylbutanoyl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47076419 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-[1-(4-cyclohexylbutanoyl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)CCCC2CCCCC2)CC1)c1cccnc1 |
| InChI | InChI=1S/C21H31N3O2/c25-20(10-4-8-17-6-2-1-3-7-17)24-14-11-19(12-15-24)23-21(26)18-9-5-13-22-16-18/h5,9,13,16-17,19H,1-4,6-8,10-12,14-15H2,(H,23,26) |
| InChIKey | LMPOPIBCZJDDOE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |