C16H24N4O2 — CID 124595352
N-[2-[[(3R,4R)-3,4-dimethylpiperidine-1-carbonyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 124595352) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[2-[[(3R,4R)-3,4-dimethylpiperidine-1-carbonyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[(3R,4R)-3,4-dimethylpiperidine-1-carbonyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124595352 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-[2-[[(3R,4R)-3,4-dimethylpiperidine-1-carbonyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | C[C@@H]1CCN(C(=O)NCCNC(=O)c2cccnc2)C[C@@H]1C |
| InChI | InChI=1S/C16H24N4O2/c1-12-5-9-20(11-13(12)2)16(22)19-8-7-18-15(21)14-4-3-6-17-10-14/h3-4,6,10,12-13H,5,7-9,11H2,1-2H3,(H,18,21)(H,19,22)/t12-,13+/m1/s1 |
| InChIKey | YXHLTBQWWUKOEP-OLZOCXBDSA-N |
| XLogP | 1.50 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|