C18H23N3O2 — CID 47796916
N-[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 47796916) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47796916 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)C2CC=CCC2)CC1)c1cccnc1 |
| InChI | InChI=1S/C18H23N3O2/c22-17(15-7-4-10-19-13-15)20-16-8-11-21(12-9-16)18(23)14-5-2-1-3-6-14/h1-2,4,7,10,13-14,16H,3,5-6,8-9,11-12H2,(H,20,22) |
| InChIKey | JNLPXXGTIXOQHN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|