C16H14N2O5 — CID 6493270
2-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]benzamide (PubChem CID 6493270) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]benzamide.
| Compound Name | 2-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 6493270 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14N2O5/c17-16(20)11-3-1-2-4-12(11)18-15(19)8-21-10-5-6-13-14(7-10)23-9-22-13/h1-7H,8-9H2,(H2,17,20)(H,18,19) |
| InChIKey | AWAWZAROLUEMGA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |