C16H11ClN2O4 — CID 7894399
2-(1,3-benzodioxol-5-yloxy)-N-(5-chloro-2-cyanophenyl)acetamide (PubChem CID 7894399) has the molecular formula C16H11ClN2O4 and a molecular weight of 330.73 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-(5-chloro-2-cyanophenyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-(5-chloro-2-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 7894399 |
| Molecular Formula | C16H11ClN2O4 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-(5-chloro-2-cyanophenyl)acetamide |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H11ClN2O4/c17-11-2-1-10(7-18)13(5-11)19-16(20)8-21-12-3-4-14-15(6-12)23-9-22-14/h1-6H,8-9H2,(H,19,20) |
| InChIKey | NSNMWJHQJXVXTP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |