C15H11ClN2O6 — CID 17310210
2-(1,3-benzodioxol-5-yloxy)-N-(2-chloro-5-nitrophenyl)acetamide (PubChem CID 17310210) has the molecular formula C15H11ClN2O6 and a molecular weight of 350.71 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-(2-chloro-5-nitrophenyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-(2-chloro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17310210 |
| Molecular Formula | C15H11ClN2O6 |
| Molecular Weight | 350.71 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-(2-chloro-5-nitrophenyl)acetamide |
| SMILES | O=C(COc1ccc2c(c1)OCO2)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C15H11ClN2O6/c16-11-3-1-9(18(20)21)5-12(11)17-15(19)7-22-10-2-4-13-14(6-10)24-8-23-13/h1-6H,7-8H2,(H,17,19) |
| InChIKey | QJEDHTBOTSFGAL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|