C18H18N2O5 — CID 29454663
3-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 29454663) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 29454663 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)COc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C18H18N2O5/c1-20(2)18(22)12-4-3-5-13(8-12)19-17(21)10-23-14-6-7-15-16(9-14)25-11-24-15/h3-9H,10-11H2,1-2H3,(H,19,21) |
| InChIKey | AEDLROGHVDTTFC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |