C19H22N2O7S — CID 91954213
2-(1,3-benzodioxol-5-yloxy)-N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]acetamide (PubChem CID 91954213) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 91954213 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]acetamide |
| SMILES | COCCNS(=O)(=O)Cc1cccc(NC(=O)COc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C19H22N2O7S/c1-25-8-7-20-29(23,24)12-14-3-2-4-15(9-14)21-19(22)11-26-16-5-6-17-18(10-16)28-13-27-17/h2-6,9-10,20H,7-8,11-13H2,1H3,(H,21,22) |
| InChIKey | SIBNVBQOJACNGD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|