C15H22N2O5S — CID 91954252
N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]oxolane-2-carboxamide (PubChem CID 91954252) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 91954252 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]oxolane-2-carboxamide |
| SMILES | COCCNS(=O)(=O)Cc1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C15H22N2O5S/c1-21-9-7-16-23(19,20)11-12-4-2-5-13(10-12)17-15(18)14-6-3-8-22-14/h2,4-5,10,14,16H,3,6-9,11H2,1H3,(H,17,18) |
| InChIKey | NHFFHERFKBUGQP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|