C16H25ClN2O2 — CID 112977192
1-butyl-3-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-1-methylurea (PubChem CID 112977192) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 1-butyl-3-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-1-methylurea.
| Compound Name | 1-butyl-3-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 112977192 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-butyl-3-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-1-methylurea |
| SMILES | CCCCN(C)C(=O)NCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C16H25ClN2O2/c1-5-6-8-19(4)16(20)18-7-9-21-14-10-12(2)15(17)13(3)11-14/h10-11H,5-9H2,1-4H3,(H,18,20) |
| InChIKey | RIMPBDSUMLPKNX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|