C22H28IN3O4 — CID 109427806
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide (PubChem CID 109427806) has the molecular formula C22H28IN3O4 and a molecular weight of 525.39 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109427806 |
| Molecular Formula | C22H28IN3O4 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc2c(c1)OCO2)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H27N3O4.HI/c1-23-22(24-11-14-26-19-7-8-20-21(15-19)28-16-27-20)25-12-9-18(10-13-25)29-17-5-3-2-4-6-17;/h2-8,15,18H,9-14,16H2,1H3,(H,23,24);1H |
| InChIKey | MJSCQMCZAYJLBQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|