C20H25FN6O — CID 111586769
1-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111586769) has the molecular formula C20H25FN6O and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111586769 |
| Molecular Formula | C20H25FN6O |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2)c(F)c1)NCc1cc(C(C)C)no1 |
| InChI | InChI=1S/C20H25FN6O/c1-4-23-20(25-12-16-10-18(14(2)3)26-28-16)24-11-15-5-6-19(17(21)9-15)27-8-7-22-13-27/h5-10,13-14H,4,11-12H2,1-3H3,(H2,23,24,25) |
| InChIKey | PTVZBILKWNLHFW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|