C15H23F3IN5 — CID 111915192
2-methyl-1-(2-pyridin-3-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111915192) has the molecular formula C15H23F3IN5 and a molecular weight of 457.28 g/mol. Its IUPAC name is 2-methyl-1-(2-pyridin-3-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-pyridin-3-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111915192 |
| Molecular Formula | C15H23F3IN5 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-methyl-1-(2-pyridin-3-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccnc1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C15H22F3N5.HI/c1-19-14(21-7-4-12-3-2-6-20-9-12)22-13-5-8-23(10-13)11-15(16,17)18;/h2-3,6,9,13H,4-5,7-8,10-11H2,1H3,(H2,19,21,22);1H |
| InChIKey | LGXUMGKFVACZQZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|